EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34N2O6 |
| Net Charge | 0 |
| Average Mass | 398.500 |
| Monoisotopic Mass | 398.24169 |
| SMILES | C=C(C)C[C@H](NC(=O)[C@H](CO)NC(=O)CCCCC(C)C)C(=O)[C@@]1(CO)CO1 |
| InChI | InChI=1S/C20H34N2O6/c1-13(2)7-5-6-8-17(25)21-16(10-23)19(27)22-15(9-14(3)4)18(26)20(11-24)12-28-20/h13,15-16,23-24H,3,5-12H2,1-2,4H3,(H,21,25)(H,22,27)/t15-,16-,20+/m0/s1 |
| InChIKey | ZPLVYYNMRMBNGE-TWOQFEAHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (2106503) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Eponemycin (CHEBI:220171) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| N-[(2S)-3-hydroxy-1-[[(2S)-1-[(2R)-2-(hydroxymethyl)oxiran-2-yl]-4-methyl-1-oxopent-4-en-2-yl]amino]-1-oxopropan-2-yl]-6-methylheptanamide |
| Manual Xrefs | Databases |
|---|---|
| 8267816 | ChemSpider |