EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O4 |
| Net Charge | 0 |
| Average Mass | 332.440 |
| Monoisotopic Mass | 332.19876 |
| SMILES | C=C[C@]1(C)C=C2C(O)C(O)C3C(C)(C)C(=O)C=C[C@]3(C)[C@@]2(O)CC1 |
| InChI | InChI=1S/C20H28O4/c1-6-18(4)9-10-20(24)12(11-18)14(22)15(23)16-17(2,3)13(21)7-8-19(16,20)5/h6-8,11,14-16,22-24H,1,9-10H2,2-5H3/t14?,15?,16?,18-,19-,20+/m0/s1 |
| InChIKey | RNZJQFGWISERJP-CNENOYCWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eutypellaspecies FS46 (ncbitaxon:1842088) | - | PubMed (27050657) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Scopararane H (CHEBI:220162) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (4aS,4bS,7R)-7-ethenyl-4b,9,10-trihydroxy-1,1,4a,7-tetramethyl-6,9,10,10a-tetrahydro-5H-phenanthren-2-one |
| Manual Xrefs | Databases |
|---|---|
| 78445375 | ChemSpider |