EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12AsNO4 |
| Net Charge | 0 |
| Average Mass | 225.076 |
| Monoisotopic Mass | 224.99823 |
| SMILES | C[As](=O)(O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H12AsNO4/c1-6(10,11)3-2-4(7)5(8)9/h4H,2-3,7H2,1H3,(H,8,9)(H,10,11)/t4-/m0/s1 |
| InChIKey | CXTQPLOKUBDLTK-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia (ncbitaxon:32008) | - | DOI (10.1071/EN14247) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arsinothricin (CHEBI:220158) is a α-amino acid (CHEBI:33704) |