EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H30O6 |
| Net Charge | 0 |
| Average Mass | 534.608 |
| Monoisotopic Mass | 534.20424 |
| SMILES | O=C1O[C@]2(C(O)c3ccccc3)[C@@H](c3ccccc3)C[C@H](O)[C@](O)(c3ccccc3)[C@]23O[C@]13Cc1ccccc1 |
| InChI | InChI=1S/C34H30O6/c35-28-21-27(24-15-7-2-8-16-24)33(29(36)25-17-9-3-10-18-25)34(32(28,38)26-19-11-4-12-20-26)31(40-34,30(37)39-33)22-23-13-5-1-6-14-23/h1-20,27-29,35-36,38H,21-22H2/t27-,28+,29?,31-,32-,33+,34+/m1/s1 |
| InChIKey | NMHJQXMIRNYVEX-JEQGAVSCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kyrtuthrix (ncbitaxon:1906669) | - | PubMed (9548830) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maculalactone H (CHEBI:220110) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1aS,3aS,4R,6S,7R,7aS)-1a-benzyl-6,7-dihydroxy-3a-[hydroxy(phenyl)methyl]-4,7-diphenyl-5,6-dihydro-4H-oxireno[2,3-c][1]benzouran-2-one |
| Manual Xrefs | Databases |
|---|---|
| 10229240 | ChemSpider |