EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40O3 |
| Net Charge | 0 |
| Average Mass | 388.592 |
| Monoisotopic Mass | 388.29775 |
| SMILES | C/C1=C2\CC[C@@H](C)[C@@H]2CC[C@H](C)[C@H]2C[C@@]3(C(=O)O)CC[C@H](C(C)C)[C@@H]3C[C@]12O |
| InChI | InChI=1S/C25H40O3/c1-14(2)18-10-11-24(23(26)27)12-21-16(4)7-8-19-15(3)6-9-20(19)17(5)25(21,28)13-22(18)24/h14-16,18-19,21-22,28H,6-13H2,1-5H3,(H,26,27)/b20-17-/t15-,16+,18-,19+,21-,22+,24+,25+/m1/s1 |
| InChIKey | SLCDJJDPKICHGM-ZIFIXUEUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus oryzae (ncbitaxon:5062) | - | PubMed (26332841) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sesterfisheric acid (CHEBI:220103) is a sesterterpenoid (CHEBI:26660) |
| Sesterfisheric acid (CHEBI:220103) is conjugate acid of sesterfisherate (CHEBI:228367) |
| Incoming Relation(s) |
| sesterfisherate (CHEBI:228367) is conjugate base of Sesterfisheric acid (CHEBI:220103) |
| IUPAC Name |
|---|
| (1R,2Z,6R,7S,10S,11R,13S,16R,17S)-1-hydroxy-2,6,10-trimethyl-16-propan-2-yltetracyclo[9.7.0.03,7.013,17]octadec-2-ene-13-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 35517213 | ChemSpider |