EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H28N2O3 |
| Net Charge | 0 |
| Average Mass | 416.521 |
| Monoisotopic Mass | 416.20999 |
| SMILES | C=CC(C)(C)[C@]12C[C@@H]3C(=O)O[C@H](Cc4ccccc4)C(=O)N3[C@H]1N(C)c1ccccc12 |
| InChI | InChI=1S/C26H28N2O3/c1-5-25(2,3)26-16-20-23(30)31-21(15-17-11-7-6-8-12-17)22(29)28(20)24(26)27(4)19-14-10-9-13-18(19)26/h5-14,20-21,24H,1,15-16H2,2-4H3/t20-,21-,24-,26+/m1/s1 |
| InChIKey | HZOLEYOVBYTDAS-LUHVKKMXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus aculeatus (ncbitaxon:5053) | - | PubMed (25068785) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acu-dioxomorpholine (CHEBI:220088) is a N-acyl-amino acid (CHEBI:51569) |