EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38O8 |
| Net Charge | 0 |
| Average Mass | 514.615 |
| Monoisotopic Mass | 514.25667 |
| SMILES | CCC(=O)CC[C@]1(C)OC[C@]23C(=O)C(=O)C4=C(C(=O)C[C@@H]([C@@]5(C)CO5)[C@]4(C)CCC(=O)O)[C@]2(C)CC[C@H]13 |
| InChI | InChI=1S/C29H38O8/c1-6-16(30)7-12-27(4)18-8-11-26(3)21-17(31)13-19(28(5)14-36-28)25(2,10-9-20(32)33)22(21)23(34)24(35)29(18,26)15-37-27/h18-19H,6-15H2,1-5H3,(H,32,33)/t18-,19-,25+,26+,27+,28-,29+/m1/s1 |
| InChIKey | ASUPBUQSWCPYPH-HDXHAILPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma boninense (ncbitaxon:34458) | - | DOI (10.1016/j.tet.2015.02.002) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ganoboninone A (CHEBI:220049) is a carbocyclic fatty acid (CHEBI:35744) |
| IUPAC Name |
|---|
| 3-[(1R,5S,6R,10S,13S,14S)-5,10,14-trimethyl-6-[(2S)-2-methyloxiran-2-yl]-2,3,8-trioxo-14-(3-oxopentyl)-15-oxatetracyclo[8.6.0.01,13.04,9]hexadec-4(9)-en-5-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438198 | ChemSpider |