EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H55N5O9 |
| Net Charge | 0 |
| Average Mass | 641.807 |
| Monoisotopic Mass | 641.39998 |
| SMILES | CCCCCCCCCC(=O)N[C@@H]1C(=O)N[C@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@H](C(C)C)C(=O)NC([C@@H](C)CC)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C31H55N5O9/c1-7-9-10-11-12-13-14-15-23(39)34-26-20(6)45-31(44)25(19(5)8-2)36-29(42)24(18(3)4)35-28(41)22(17-38)32-27(40)21(16-37)33-30(26)43/h18-22,24-26,37-38H,7-17H2,1-6H3,(H,32,40)(H,33,43)(H,34,39)(H,35,41)(H,36,42)/t19-,20+,21+,22-,24+,25?,26-/m0/s1 |
| InChIKey | ZYMPQDJNXLRYDT-VUFXYZLVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Serratiaspecies (in: enterobacteria) (ncbitaxon:616) | - | PubMed (29700993) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stephensiolide D (CHEBI:219988) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| N-[(6R,9S,12R,15S,16R)-3-[(2S)-butan-2-yl]-9,12-bis(hydroxymethyl)-16-methyl-2,5,8,11,14-pentaoxo-6-propan-2-yl-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]decanamide |
| Manual Xrefs | Databases |
|---|---|
| 78440655 | ChemSpider |