EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H55N5O9 |
| Net Charge | 0 |
| Average Mass | 653.818 |
| Monoisotopic Mass | 653.39998 |
| SMILES | CCCCCC/C=C\CCCC(=O)N[C@@H]1C(=O)N[C@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@H](C(C)C)C(=O)NC(C(C)C)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C32H55N5O9/c1-7-8-9-10-11-12-13-14-15-16-24(40)35-27-21(6)46-32(45)26(20(4)5)37-30(43)25(19(2)3)36-29(42)23(18-39)33-28(41)22(17-38)34-31(27)44/h12-13,19-23,25-27,38-39H,7-11,14-18H2,1-6H3,(H,33,41)(H,34,44)(H,35,40)(H,36,42)(H,37,43)/b13-12-/t21-,22-,23+,25-,26?,27+/m1/s1 |
| InChIKey | HUOLEEQTSYOYMZ-YEOJVNFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Serratiaspecies (in: enterobacteria) (ncbitaxon:616) | - | PubMed (29700993) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Stephensiolide E (CHEBI:219983) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (Z)-N-[(6R,9S,12R,15S,16R)-9,12-bis(hydroxymethyl)-16-methyl-2,5,8,11,14-pentaoxo-3,6-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadec-15-yl]dodec-5-enamide |
| Manual Xrefs | Databases |
|---|---|
| 78440654 | ChemSpider |