EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20N2O8S2 |
| Net Charge | 0 |
| Average Mass | 504.542 |
| Monoisotopic Mass | 504.06611 |
| SMILES | CC(=O)OC1C=COC=C2CC34SSC5(CC6=COC=CC(OC(C)=O)C6N5C3=O)C(=O)N4C21 |
| InChI | InChI=1S/C22H20N2O8S2/c1-11(25)31-15-3-5-29-9-13-7-21-20(28)24-18-14(10-30-6-4-16(18)32-12(2)26)8-22(24,34-33-21)19(27)23(21)17(13)15/h3-6,9-10,15-18H,7-8H2,1-2H3 |
| InChIKey | OHTZNUUGYPDWEB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | - | DOI (10.1271/bbb1961.47.2637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acetylaranotin (CHEBI:219971) is a 2,5-diketopiperazines (CHEBI:65061) |
| Acetylaranotin (CHEBI:219971) is a indoles (CHEBI:24828) |
| Acetylaranotin (CHEBI:219971) is a organic disulfide (CHEBI:35489) |
| Acetylaranotin (CHEBI:219971) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (16-acetyloxy-2,13-dioxo-8,19-dioxa-23,24-dithia-3,14-diazahexacyclo[10.10.2.01,14.03,12.04,10.015,21]tetracosa-6,9,17,20-tetraen-5-yl) acetate |
| Manual Xrefs | Databases |
|---|---|
| 141705 | ChemSpider |