EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H16O9 |
| Net Charge | 0 |
| Average Mass | 400.339 |
| Monoisotopic Mass | 400.07943 |
| SMILES | C[C@@H]1CC(=O)[C@@H](O)[C@]2(O1)O[C@@H]1CC(=O)O[C@@H]1C1=C2C(=O)c2c(O)cccc2C1=O |
| InChI | InChI=1S/C20H16O9/c1-7-5-10(22)19(26)20(28-7)15-14(18-11(29-20)6-12(23)27-18)16(24)8-3-2-4-9(21)13(8)17(15)25/h2-4,7,11,18-19,21,26H,5-6H2,1H3/t7-,11-,18+,19-,20-/m1/s1 |
| InChIKey | SKZDTPBXHXHCTG-OTWGEVNPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsis (ncbitaxon:2013) | - | PubMed (17877337) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4'-dehydro-deacetylgriseusin A (CHEBI:219967) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| (3'R,6'R,11R,15R,17R)-3',4-dihydroxy-6'-methylspiro[12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3(8),4,6-tetraene-17,2'-oxane]-2,4',9,13-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 23289499 | ChemSpider |