EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32N4O7 |
| Net Charge | 0 |
| Average Mass | 488.541 |
| Monoisotopic Mass | 488.22710 |
| SMILES | NCCCCNC(=O)[C@H](CCCCNC(=O)c1cccc(O)c1O)NC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C24H32N4O7/c25-12-2-4-14-27-24(35)17(28-23(34)16-8-6-11-19(30)21(16)32)9-1-3-13-26-22(33)15-7-5-10-18(29)20(15)31/h5-8,10-11,17,29-32H,1-4,9,12-14,25H2,(H,26,33)(H,27,35)(H,28,34)/t17-/m0/s1 |
| InChIKey | IKCYQZGLTBAIOD-KRWDZBQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia (ncbitaxon:32008) | - | DOI (10.1515/znc-1996-9-1004) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cepaciachelin (CHEBI:219953) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| N-[6-(4-aminobutylamino)-5-[(2,3-dihydroxybenzoyl)amino]-6-oxohexyl]-2,3-dihydroxybenzamide |