EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H36N4O10 |
| Net Charge | 0 |
| Average Mass | 624.647 |
| Monoisotopic Mass | 624.24314 |
| SMILES | O=C(NCCCCNC(=O)[C@H](CCCCNC(=O)c1cccc(O)c1O)NC(=O)c1cccc(O)c1O)c1cccc(O)c1O |
| InChI | InChI=1S/C31H36N4O10/c36-22-12-5-8-18(25(22)39)28(42)32-15-2-1-11-21(35-30(44)20-10-7-14-24(38)27(20)41)31(45)34-17-4-3-16-33-29(43)19-9-6-13-23(37)26(19)40/h5-10,12-14,21,36-41H,1-4,11,15-17H2,(H,32,42)(H,33,43)(H,34,45)(H,35,44)/t21-/m0/s1 |
| InChIKey | FRTUVWLJPRMTFC-NRFANRHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Azotobacter vinelandii (ncbitaxon:354) | - | DOI (10.1007/BF00141607) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Protochelin (CHEBI:219946) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| N-[5-[(2,3-dihydroxybenzoyl)amino]-6-[4-[(2,3-dihydroxybenzoyl)amino]butylamino]-6-oxohexyl]-2,3-dihydroxybenzamide |