EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O3 |
| Net Charge | 0 |
| Average Mass | 328.412 |
| Monoisotopic Mass | 328.17869 |
| SMILES | C=CC(C)(C)n1cc(C[C@H](NC(C)=O)C(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O3/c1-6-19(3,4)21-12-14(15-9-7-8-10-17(15)21)11-16(18(23)24-5)20-13(2)22/h6-10,12,16H,1,11H2,2-5H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | REAIGAUYAUSOEN-INIZCTEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium fujikuroi (ncbitaxon:5127) | - | PubMed (28295904) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl-ac-r-N-DMAT (CHEBI:219922) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| methyl 2-acetamido-3-[1-(2-methylbut-3-en-2-yl)indol-3-yl]propanoate |
| Manual Xrefs | Databases |
|---|---|
| 78435818 | ChemSpider |