EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O2 |
| Net Charge | 0 |
| Average Mass | 272.348 |
| Monoisotopic Mass | 272.15248 |
| SMILES | C=CC(C)(C)n1cc(C[C@H](N)C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C16H20N2O2/c1-4-16(2,3)18-10-11(9-13(17)15(19)20)12-7-5-6-8-14(12)18/h4-8,10,13H,1,9,17H2,2-3H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | LOCNLUOBLWSOIZ-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium fujikuroi (ncbitaxon:5127) | - | PubMed (28295904) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| R-N-DMAT (CHEBI:219911) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-[1-(2-methylbut-3-en-2-yl)indol-3-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 20045999 | ChemSpider |