EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H42N6O6 |
| Net Charge | 0 |
| Average Mass | 594.713 |
| Monoisotopic Mass | 594.31658 |
| SMILES | C[C@H]1C[C@@H](C(=O)NC(C=O)CCCN=C(N)N)N(C(=O)[C@@H](CCc2ccccc2)NC(=O)[C@H](O)Cc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C31H42N6O6/c1-20-16-26(28(41)35-23(19-38)8-5-15-34-31(32)33)37(18-20)30(43)25(14-11-21-6-3-2-4-7-21)36-29(42)27(40)17-22-9-12-24(39)13-10-22/h2-4,6-7,9-10,12-13,19-20,23,25-27,39-40H,5,8,11,14-18H2,1H3,(H,35,41)(H,36,42)(H4,32,33,34)/t20-,23?,25+,26-,27+/m0/s1 |
| InChIKey | YGAGCUYKOBGAQX-SYCDWYGJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nodulariaspeciesmigena (ncbitaxon:70799) | - | PubMed (19691450) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spumigin G (CHEBI:219896) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2S,4S)-N-[5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-[(2R)-2-[[(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-4-phenylbutanoyl]-4-methylpyrrolidine-2-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 78442853 | ChemSpider |