EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H40N10O5 |
| Net Charge | 0 |
| Average Mass | 500.605 |
| Monoisotopic Mass | 500.31831 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CO)NC(=O)NCCCCN=C(N)N)C(=O)N[C@H]1CCCN(C(=N)N)[C@@H]1O |
| InChI | InChI=1S/C20H40N10O5/c1-11(2)14(16(33)27-12-6-5-9-30(17(12)34)19(23)24)29-15(32)13(10-31)28-20(35)26-8-4-3-7-25-18(21)22/h11-14,17,31,34H,3-10H2,1-2H3,(H3,23,24)(H,27,33)(H,29,32)(H4,21,22,25)(H2,26,28,35)/t12-,13-,14-,17+/m0/s1 |
| InChIKey | LWCQPGWFMIZITF-AYMQEEERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (27498895) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lichostatinal (CHEBI:219878) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-N-[(2R,3S)-1-carbamimidoyl-2-hydroxypiperidin-3-yl]-2-[[(2S)-2-[4-(diaminomethylideneamino)butylcarbamoylamino]-3-hydroxypropanoyl]amino]-3-methylbutanamide |