EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30N10O8 |
| Net Charge | 0 |
| Average Mass | 538.522 |
| Monoisotopic Mass | 538.22481 |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(C(=O)O)C1OC(n2cnc3cnc(N)nc32)C2OCC(O)C2(O)C1O |
| InChI | InChI=1S/C20H30N10O8/c21-7(2-1-3-25-18(22)23)15(33)28-10(17(34)35)11-12(32)20(36)9(31)5-37-13(20)16(38-11)30-6-27-8-4-26-19(24)29-14(8)30/h4,6-7,9-13,16,31-32,36H,1-3,5,21H2,(H,28,33)(H,34,35)(H4,22,23,25)(H2,24,26,29) |
| InChIKey | JOTXNJQBWBCEHD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1016/s0040-4039(00)81775-x) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Miharamycin B (CHEBI:219853) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-2-[7-(2-aminopurin-9-yl)-3,3a,4-trihydroxy-2,3,4,5,7,7a-hexahydrouro[2,3-c]pyran-5-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 175426 | ChemSpider |