EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H38N4O10 |
| Net Charge | 0 |
| Average Mass | 638.674 |
| Monoisotopic Mass | 638.25879 |
| SMILES | CC(O)C(NC(=O)c1ccccc1O)C(=O)N(CCCCNC(=O)c1cccc(O)c1O)CCCNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C32H38N4O10/c1-19(37)26(35-31(45)20-9-2-3-12-23(20)38)32(46)36(18-8-16-34-30(44)22-11-7-14-25(40)28(22)42)17-5-4-15-33-29(43)21-10-6-13-24(39)27(21)41/h2-3,6-7,9-14,19,26,37-42H,4-5,8,15-18H2,1H3,(H,33,43)(H,34,44)(H,35,45) |
| InChIKey | IAIZSZNKARETRA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paracoccus (ncbitaxon:265) | - | DOI (10.1016/S0040-4039(01)86717-4) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Parabactin A (CHEBI:219825) is a N-acylglycine (CHEBI:16180) |