EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34N3O4S |
| Net Charge | +1 |
| Average Mass | 496.653 |
| Monoisotopic Mass | 496.22645 |
| SMILES | CC(C)CCC(CC=CC#CC#C/C=C1/C=CSc2nc(CC(C(=O)O)[N+](C)(C)C)cn21)C(=O)O |
| InChI | InChI=1S/C27H33N3O4S/c1-20(2)14-15-21(25(31)32)12-10-8-6-7-9-11-13-23-16-17-35-27-28-22(19-29(23)27)18-24(26(33)34)30(3,4)5/h8,10,13,16-17,19-21,24H,12,14-15,18H2,1-5H3,(H-,31,32,33,34)/p+1/b10-8?,23-13- |
| InChIKey | XUBRYJDBDQQVDA-IXYMSPMCSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gynuella sunshinyii (ncbitaxon:1445505) | - | PubMed (30025185) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ergoyne B (CHEBI:219812) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| [1-carboxy-2-[(5Z)-5-(9-carboxy-12-methyltridec-6-en-2,4-diynylidene)imidazo[2,1-b][1,3]thiazin-2-yl]ethyl]-trimethylazanium |