EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H36O7 |
| Net Charge | 0 |
| Average Mass | 400.512 |
| Monoisotopic Mass | 400.24610 |
| SMILES | CC[C@@H](C[C@@H]1CC[C@H]([C@@H](C)C(=O)O)O1)OC(=O)[C@@H](C)[C@H]1CC[C@@H](C[C@H](C)O)O1 |
| InChI | InChI=1S/C21H36O7/c1-5-15(11-17-7-8-18(27-17)13(3)20(23)24)28-21(25)14(4)19-9-6-16(26-19)10-12(2)22/h12-19,22H,5-11H2,1-4H3,(H,23,24)/t12-,13+,14-,15-,16-,17-,18+,19+/m0/s1 |
| InChIKey | LAHVNDBOZVIZMO-QCDRYKFJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces globisporus (ncbitaxon:1908) | - | DOI (10.1016/j.tet.2004.04.006) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-2-[(2R,5S)-5-[(2S)-2-[(2S)-2-[(2R,5S)-5-[(2S)-2-hydroxypropyl]oxolan-2-yl]propanoyl]oxybutyl]oxolan-2-yl]propanoic acid (CHEBI:219811) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (2R)-2-[(2R,5S)-5-[(2S)-2-[(2S)-2-[(2R,5S)-5-[(2S)-2-hydroxypropyl]oxolan-2-yl]propanoyl]oxybutyl]oxolan-2-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9558938 | ChemSpider |