EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44N6O5 |
| Net Charge | 0 |
| Average Mass | 520.675 |
| Monoisotopic Mass | 520.33732 |
| SMILES | C/C=C1/CN(C(=O)[C@H](CCCCNC(=N)N)NC(=O)C=C(C)C)C(C(=O)N[C@@H](CC(C)C)C(=O)O)[C@@H]1C |
| InChI | InChI=1S/C26H44N6O5/c1-7-18-14-32(22(17(18)6)23(34)31-20(25(36)37)12-15(2)3)24(35)19(30-21(33)13-16(4)5)10-8-9-11-29-26(27)28/h7,13,15,17,19-20,22H,8-12,14H2,1-6H3,(H,30,33)(H,31,34)(H,36,37)(H4,27,28,29)/b18-7-/t17-,19+,20+,22?/m1/s1 |
| InChIKey | GJZRJQAXSVMSAB-KJPCRPCSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nocardiopsis lucentensis (ncbitaxon:53441) | - | PubMed (17630797) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lucentamycin D (CHEBI:219809) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(3R,4E)-1-[(2S)-6-(diaminomethylideneamino)-2-(3-methylbut-2-enoylamino)hexanoyl]-4-ethylidene-3-methylpyrrolidine-2-carbonyl]amino]-4-methylpentanoic acid |