EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O6 |
| Net Charge | 0 |
| Average Mass | 294.263 |
| Monoisotopic Mass | 294.08519 |
| SMILES | C[C@H](NC(=O)CC(=O)O)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C13H14N2O6/c1-7(14-10(16)6-11(17)18)12(19)15-9-5-3-2-4-8(9)13(20)21/h2-5,7H,6H2,1H3,(H,14,16)(H,15,19)(H,17,18)(H,20,21)/t7-/m0/s1 |
| InChIKey | LCKFAMIWUNBCPL-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium chrysogenum (ncbitaxon:5076) | - | PubMed (29196288) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-[2-[(2-carboxyacetyl)amino]propanoylamino]benzoic acid (CHEBI:219802) is a amidobenzoic acid (CHEBI:48470) |
| IUPAC Name |
|---|
| 2-[2-[(2-carboxyacetyl)amino]propanoylamino]benzoic acid |