EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O2 |
| Net Charge | 0 |
| Average Mass | 234.299 |
| Monoisotopic Mass | 234.13683 |
| SMILES | COC(=O)/C=C/c1c(CC=C(C)C)ncn1C |
| InChI | InChI=1S/C13H18N2O2/c1-10(2)5-6-11-12(15(3)9-14-11)7-8-13(16)17-4/h5,7-9H,6H2,1-4H3/b8-7+ |
| InChIKey | LFPQYOYKAPGCGM-BQYQJAHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium tricinctum (ncbitaxon:61284) | - | DOI (10.1021/jf00037a035) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Visoltricin (CHEBI:219801) is a imidazolyl carboxylic acid (CHEBI:38307) |
| IUPAC Name |
|---|
| methyl (E)-3-[3-methyl-5-(3-methylbut-2-enyl)imidazol-4-yl]prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 4534848 | ChemSpider |