EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8N4O2 |
| Net Charge | 0 |
| Average Mass | 156.145 |
| Monoisotopic Mass | 156.06473 |
| SMILES | N[C@H](Cc1ncnn1)C(=O)O |
| InChI | InChI=1S/C5H8N4O2/c6-3(5(10)11)1-4-7-2-8-9-4/h2-3H,1,6H2,(H,10,11)(H,7,8,9)/t3-/m1/s1 |
| InChIKey | CAPORZWUTKSILW-GSVOUGTGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (4044411) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-1,2,4-Triazole-3-alanine (CHEBI:219765) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| (2R)-2-amino-3-(1H-1,2,4-triazol-5-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 57418901 | ChemSpider |