EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H41ClN4O6 |
| Net Charge | 0 |
| Average Mass | 529.078 |
| Monoisotopic Mass | 528.27146 |
| SMILES | CO[C@H]1CC[C@@H](C(=O)N[C@H](C(=O)N2CCCC[C@H]2C(=O)N2C[C@@H](C)C[C@H]2C(=O)O)C(C)C)N[C@@H]1CCl |
| InChI | InChI=1S/C25H41ClN4O6/c1-14(2)21(28-22(31)16-8-9-20(36-4)17(12-26)27-16)24(33)29-10-6-5-7-18(29)23(32)30-13-15(3)11-19(30)25(34)35/h14-21,27H,5-13H2,1-4H3,(H,28,31)(H,34,35)/t15-,16-,17+,18-,19-,20-,21-/m0/s1 |
| InChIKey | BJXHJDQNXSGMNG-YQUGOWONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myxococcus (ncbitaxon:32) | - | PubMed (30088846) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chloromyxamide B (CHEBI:219757) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S,4S)-1-[(2S)-1-[(2S)-2-[[(2S,5S,6S)-6-(chloromethyl)-5-methoxypiperidine-2-carbonyl]amino]-3-methylbutanoyl]piperidine-2-carbonyl]-4-methylpyrrolidine-2-carboxylic acid |