EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H39ClN4O6 |
| Net Charge | 0 |
| Average Mass | 515.051 |
| Monoisotopic Mass | 514.25581 |
| SMILES | CO[C@H]1CC[C@@H](C(=O)N[C@H](C(=O)N2CCCC[C@H]2C(=O)N2CCC[C@H]2C(=O)O)C(C)C)N[C@@H]1CCl |
| InChI | InChI=1S/C24H39ClN4O6/c1-14(2)20(27-21(30)15-9-10-19(35-3)16(13-25)26-15)23(32)28-11-5-4-7-17(28)22(31)29-12-6-8-18(29)24(33)34/h14-20,26H,4-13H2,1-3H3,(H,27,30)(H,33,34)/t15-,16+,17-,18-,19-,20-/m0/s1 |
| InChIKey | RBXSKBXFOJTNHC-XSEPRYCASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myxococcus (ncbitaxon:32) | - | PubMed (30088846) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chloromyxamide A (CHEBI:219752) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S)-1-[(2S)-1-[(2S)-2-[[(2S,5S,6S)-6-(chloromethyl)-5-methoxypiperidine-2-carbonyl]amino]-3-methylbutanoyl]piperidine-2-carbonyl]pyrrolidine-2-carboxylic acid |