EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H22O7 |
| Net Charge | 0 |
| Average Mass | 422.433 |
| Monoisotopic Mass | 422.13655 |
| SMILES | CCCC(C)C(=O)O[C@H]1c2c(cc(O)c3c2C(=O)c2cccc(O)c2-3)C(=O)[C@]2(C)O[C@H]12 |
| InChI | InChI=1S/C24H22O7/c1-4-6-10(2)23(29)30-20-16-12(21(28)24(3)22(20)31-24)9-14(26)17-15-11(19(27)18(16)17)7-5-8-13(15)25/h5,7-10,20,22,25-26H,4,6H2,1-3H3/t10?,20-,22+,24-/m0/s1 |
| InChIKey | UECRBQDJIASDQW-XCKPJGFKSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fluostatin G/H (CHEBI:219735) is a fluorenes (CHEBI:24059) |
| IUPAC Name |
|---|
| [(3S,4R,6R)-10,13-dihydroxy-6-methyl-7,18-dioxo-5-oxapentacyclo[9.7.0.02,8.04,6.012,17]octadeca-1,8,10,12(17),13,15-hexaen-3-yl] 2-methylpentanoate |
| Manual Xrefs | Databases |
|---|---|
| 78439868 | ChemSpider |