EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14O8 |
| Net Charge | 0 |
| Average Mass | 346.291 |
| Monoisotopic Mass | 346.06887 |
| SMILES | C/C=C/c1cc2c(c(=O)o1)-c1c(O)c(O)c(OC)c(C(=O)O)c1CO2 |
| InChI | InChI=1S/C17H14O8/c1-3-4-7-5-9-12(17(22)25-7)10-8(6-24-9)11(16(20)21)15(23-2)14(19)13(10)18/h3-5,18-19H,6H2,1-2H3,(H,20,21)/b4-3+ |
| InChIKey | PBCHQXZFXJSKDT-ONEGZZNKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyathusspecies (ncbitaxon:1967125) | - | PubMed (18565749) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyathuscavin A (CHEBI:219655) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 9,10-dihydroxy-8-methoxy-1-oxo-3-[(E)-prop-1-enyl]-6H-pyrano[4,3-c]isochromene-7-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 23342207 | ChemSpider |