EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31N5O7 |
| Net Charge | 0 |
| Average Mass | 549.584 |
| Monoisotopic Mass | 549.22235 |
| SMILES | CC[C@H](C)[C@H](NC)C(=O)NC1=C(c2ccc(O)cc2)N2c3ccccc3[C@H]3[C@H](OC(N)=O)[C@@H](C(=O)O)N(C1=O)[C@H]32 |
| InChI | InChI=1S/C28H31N5O7/c1-4-13(2)19(30-3)24(35)31-20-21(14-9-11-15(34)12-10-14)32-17-8-6-5-7-16(17)18-23(40-28(29)39)22(27(37)38)33(25(18)32)26(20)36/h5-13,18-19,22-23,25,30,34H,4H2,1-3H3,(H2,29,39)(H,31,35)(H,37,38)/t13-,18-,19-,22-,23-,25+/m0/s1 |
| InChIKey | VJSALQKIBNEDBI-HMXBKABSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chondromyces (ncbitaxon:50) | - | PubMed (28544148) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Crocagin B (CHEBI:219633) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (8R,9S,10S,15R)-9-carbamoyloxy-14-(4-hydroxyphenyl)-13-[[(2S,3S)-3-methyl-2-(methylamino)pentanoyl]amino]-12-oxo-1,11-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-2,4,6,13-tetraene-10-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443348 | ChemSpider |