EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:219599 - Enantiopyochelin
| Formula | C14H16N2O3S2 |
| Net Charge | 0 |
| Average Mass | 324.427 |
| Monoisotopic Mass | 324.06023 |
| SMILES | CN1C([C@@H]2CSC(c3ccccc3O)=N2)SC[C@@H]1C(=O)O |
| InChI | InChI=1S/C14H16N2O3S2/c1-16-10(14(18)19)7-21-13(16)9-6-20-12(15-9)8-4-2-3-5-11(8)17/h2-5,9-10,13,17H,6-7H2,1H3,(H,18,19)/t9-,10+,13?/m0/s1 |
| InChIKey | NYBZAGXTZXPYND-RGPRDZHESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas protegens CHA0 (ncbitaxon:1124983) | - | PubMed (17938167) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Enantiopyochelin (CHEBI:219599) is a D-α-amino acid (CHEBI:16733) |
| IUPAC Name |
|---|
| (4S)-2-[(4S)-2-(2-hydroxyphenyl)-4,5-dihydro-1,3-thiazol-4-yl]-3-methyl-1,3-thiazolidine-4-carboxylic acid |