EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31Cl2N5O8 |
| Net Charge | 0 |
| Average Mass | 588.445 |
| Monoisotopic Mass | 587.15497 |
| SMILES | C[C@@H](O)[C@@H]1NC(=O)[C@@H]2[C@H](Cl)[C@H](Cl)CN2C(=O)[C@H](CO)NC(=O)C[C@H](c2ccccc2)NC(=O)[C@H](CO)NC1=O |
| InChI | InChI=1S/C24H31Cl2N5O8/c1-11(34)19-22(37)29-15(9-32)21(36)28-14(12-5-3-2-4-6-12)7-17(35)27-16(10-33)24(39)31-8-13(25)18(26)20(31)23(38)30-19/h2-6,11,13-16,18-20,32-34H,7-10H2,1H3,(H,27,35)(H,28,36)(H,29,37)(H,30,38)/t11-,13-,14-,15+,16+,18-,19+,20+/m1/s1 |
| InChIKey | SQOPWHUHNWXLMA-PQMJZOGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces islandicus (ncbitaxon:28573) | - | PubMed (18558744) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxycyclochlorotine A (CHEBI:219587) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (3S,7R,10S,13S,16R,17S,18R)-17,18-dichloro-13-[(1R)-1-hydroxyethyl]-3,10-bis(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |
| Manual Xrefs | Databases |
|---|---|
| 78438187 | ChemSpider |