EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32N4O5 |
| Net Charge | 0 |
| Average Mass | 456.543 |
| Monoisotopic Mass | 456.23727 |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C24H32N4O5/c1-14(2)20-24(33)28-12-4-5-18(28)21(30)25-17(13-15-7-9-16(29)10-8-15)23(32)27-11-3-6-19(27)22(31)26-20/h7-10,14,17-20,29H,3-6,11-13H2,1-2H3,(H,25,30)(H,26,31)/t17-,18-,19-,20-/m0/s1 |
| InChIKey | HKYOVILVNXGWMH-MUGJNUQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lactobacillus helveticus (ncbitaxon:1587) | - | DOI (10.1016/s0040-4039(00)79177-5) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclo-(L-Pro-L-Tyr-L-Pro-Val-) (CHEBI:219575) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3S,6S,12S,15S)-3-[(4-hydroxyphenyl)methyl]-12-propan-2-yl-1,4,10,13-tetrazatricyclo[13.3.0.06,10]octadecane-2,5,11,14-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 8202645 | ChemSpider |