EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N2O4S2 |
| Net Charge | 0 |
| Average Mass | 490.691 |
| Monoisotopic Mass | 490.19600 |
| SMILES | C=C1/C=C/C(CCC)=Cc2csc(n2)[C@@H](C)NC(=O)C[C@]2(CC(=O)O)CC[C@](C)(O)[C@@H](C1)S2 |
| InChI | InChI=1S/C25H34N2O4S2/c1-5-6-18-8-7-16(2)11-20-24(4,31)9-10-25(33-20,14-22(29)30)13-21(28)26-17(3)23-27-19(12-18)15-32-23/h7-8,12,15,17,20,31H,2,5-6,9-11,13-14H2,1,3-4H3,(H,26,28)(H,29,30)/b8-7+,18-12?/t17-,20-,24+,25+/m1/s1 |
| InChIKey | AJDKITCLGCYCKZ-FLBOQRJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies CB02120-2 (ncbitaxon:2020327) | - | PubMed (29229819) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Weishanmycin A1 (CHEBI:219552) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| Weishanmycin A1 (CHEBI:219552) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| 2-[(1S,5R,12E,16R,17S)-17-hydroxy-5,17-dimethyl-14-methylidene-3-oxo-11-propyl-7,20-dithia-4,21-diazatricyclo[14.3.1.16,9]henicosa-6(21),8,10,12-tetraen-1-yl]acetic acid |