EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H45N5O5 |
| Net Charge | 0 |
| Average Mass | 603.764 |
| Monoisotopic Mass | 603.34207 |
| SMILES | C=CC(C)(C)Nc1ccccc1C(=O)C[C@@H]1NC(=O)[C@H](C(C)C)NC(=O)[C@@H](C(C)C)NC(=O)[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C34H45N5O5/c1-8-34(6,7)39-24-17-13-12-16-23(24)27(40)19-26-30(41)35-25(18-22-14-10-9-11-15-22)31(42)37-29(21(4)5)33(44)38-28(20(2)3)32(43)36-26/h8-17,20-21,25-26,28-29,39H,1,18-19H2,2-7H3,(H,35,41)(H,36,43)(H,37,42)(H,38,44)/t25-,26-,28-,29+/m0/s1 |
| InChIKey | LNEVFEMBQYJQGA-ZSLRCHCDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus nidulans (ncbitaxon:162425) | - | PubMed (23248299) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nidulanin A (CHEBI:219526) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (3S,6S,9S,12R)-3-benzyl-6-[2-[2-(2-methylbut-3-en-2-ylamino)phenyl]-2-oxoethyl]-9,12-di(propan-2-yl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |