EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H47N3O12S |
| Net Charge | 0 |
| Average Mass | 709.815 |
| Monoisotopic Mass | 709.28804 |
| SMILES | COc1c(C[C@@H](C)C[C@H](OC)[C@H](O)[C@@H](C)/C=C(\C)[C@H](OC(N)=O)[C@H](/C=C\C=C(/C)C(=O)O)OC)c(O)c(NC(=O)CO)c2c1NC(=O)CS2 |
| InChI | InChI=1S/C33H47N3O12S/c1-16(11-20-28(41)25(35-23(38)14-37)31-26(30(20)47-7)36-24(39)15-49-31)12-22(46-6)27(40)18(3)13-19(4)29(48-33(34)44)21(45-5)10-8-9-17(2)32(42)43/h8-10,13,16,18,21-22,27,29,37,40-41H,11-12,14-15H2,1-7H3,(H2,34,44)(H,35,38)(H,36,39)(H,42,43)/b10-8-,17-9+,19-13+/t16-,18+,21+,22+,27-,29+/m1/s1 |
| InChIKey | FIUKMJFMFLNANA-BXTHWFJYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies AD-23-14 (ncbitaxon:1571120) | - | PubMed (28140487) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Geldanamycin G (CHEBI:219467) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2E,4Z,6S,7S,8E,10S,11R,12S,14R)-7-carbamoyloxy-11-hydroxy-15-[7-hydroxy-8-[(2-hydroxyacetyl)amino]-5-methoxy-3-oxo-4H-1,4-benzothiazin-6-yl]-6,12-dimethoxy-2,8,10,14-tetramethylpentadeca-2,4,8-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440634 | ChemSpider |