EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O4 |
| Net Charge | 0 |
| Average Mass | 306.402 |
| Monoisotopic Mass | 306.18311 |
| SMILES | CCCCC[C@@H]1Cc2cc(O)c(CCCC)c(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H26O4/c1-3-5-7-8-13-10-12-11-15(19)14(9-6-4-2)17(20)16(12)18(21)22-13/h11,13,19-20H,3-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | UKZZACSDAMLDLW-CYBMUJFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Geotrichumspecies (ncbitaxon:1907943) | - | PubMed (12762815) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-butyl-6,8-dihydroxy-3(R)-pentylisochroman-1-one (CHEBI:219440) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-7-butyl-6,8-dihydroxy-3-pentyl-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 9187405 | ChemSpider |