EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H58O10 |
| Net Charge | 0 |
| Average Mass | 650.850 |
| Monoisotopic Mass | 650.40300 |
| SMILES | CCC(C)C1OC(=O)/C=C/C=C\C=C\C=C/C=C/CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)CC(O)/C=C/C1C |
| InChI | InChI=1S/C36H58O10/c1-4-25(2)36-26(3)16-17-28(38)19-30(40)21-32(42)23-34(44)24-33(43)22-31(41)20-29(39)18-27(37)14-12-10-8-6-5-7-9-11-13-15-35(45)46-36/h5-13,15-17,25-34,36-44H,4,14,18-24H2,1-3H3/b7-5+,8-6-,11-9-,12-10+,15-13+,17-16+ |
| InChIKey | XVBIZWCWDZDOMC-ZIDJWUOVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | - | DOI (10.1039/c4ra15415k) | Strain: CHQ-64 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| reedsmycin E (CHEBI:219386) has role antifungal agent (CHEBI:35718) |
| reedsmycin E (CHEBI:219386) has role bacterial metabolite (CHEBI:76969) |
| reedsmycin E (CHEBI:219386) is a enoate ester (CHEBI:51702) |
| reedsmycin E (CHEBI:219386) is a macrolide antibiotic (CHEBI:25105) |
| reedsmycin E (CHEBI:219386) is a polyene (CHEBI:48121) |
| reedsmycin E (CHEBI:219386) is a polyol (CHEBI:26191) |
| reedsmycin E (CHEBI:219386) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| (3E,5Z,7E,9Z,11E,29E)-32-(butan-2-yl)-14,16,18,20,22,24,26,28-octahydroxy-31-methyloxacyclodotriaconta-3,5,7,9,11,29-hexaen-2-one |
| Manual Xrefs | Databases |
|---|---|
| 71048969 | ChemSpider |