EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H54N6O4 |
| Net Charge | 0 |
| Average Mass | 598.833 |
| Monoisotopic Mass | 598.42065 |
| SMILES | CN[C@H](C(=O)N[C@H](CC(C)C)C(=O)N[C@@H](C(=O)N(C)[C@@H](C(=O)NCCc1cnc2ccccc12)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C33H54N6O4/c1-19(2)17-26(37-31(41)27(34-9)20(3)4)30(40)38-28(21(5)6)33(43)39(10)29(22(7)8)32(42)35-16-15-23-18-36-25-14-12-11-13-24(23)25/h11-14,18-22,26-29,34,36H,15-17H2,1-10H3,(H,35,42)(H,37,41)(H,38,40)/t26-,27+,28-,29-/m1/s1 |
| InChIKey | QSUBRRUYBLMEBB-VJLHXPKFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus cabanillasii (ncbitaxon:351673) | - | PubMed (24038745) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhabdopeptide 8 (CHEBI:219384) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-N-[(2R)-1-[[(2R)-1-[2-(1H-indol-3-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-4-methyl-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 78442832 | ChemSpider |