EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H79N7O6 |
| Net Charge | 0 |
| Average Mass | 814.170 |
| Monoisotopic Mass | 813.60918 |
| SMILES | CN[C@@H](CC(C)C)C(=O)N(C)[C@H](CC(C)C)C(=O)N[C@@H](C(=O)N(C)[C@@H](C(=O)N(C)[C@@H](C(=O)N(C)[C@@H](C(=O)NCCc1ccccc1)C(C)C)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C45H79N7O6/c1-27(2)25-34(46-13)42(55)49(14)35(26-28(3)4)40(53)48-36(29(5)6)43(56)51(16)38(31(9)10)45(58)52(17)39(32(11)12)44(57)50(15)37(30(7)8)41(54)47-24-23-33-21-19-18-20-22-33/h18-22,27-32,34-39,46H,23-26H2,1-17H3,(H,47,54)(H,48,53)/t34-,35+,36+,37+,38+,39+/m0/s1 |
| InChIKey | ONGYRPBNULHNPU-XGCGZVRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus nematophila (ncbitaxon:628) | - | PubMed (24038745) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhabdopeptide 6 (CHEBI:219372) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-N,4-dimethyl-2-(methylamino)-N-[(2R)-4-methyl-1-[[(2R)-3-methyl-1-[methyl-[(2R)-3-methyl-1-[methyl-[(2R)-3-methyl-1-[methyl-[(2R)-3-methyl-1-oxo-1-(2-phenylethylamino)butan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxopentan-2-yl]pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 78442830 | ChemSpider |