EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H77N7O6 |
| Net Charge | 0 |
| Average Mass | 800.143 |
| Monoisotopic Mass | 799.59353 |
| SMILES | CN[C@@H](CC(C)C)C(=O)N(C)[C@@H](C(=O)N[C@@H](C(=O)N(C)[C@@H](C(=O)N(C)[C@@H](C(=O)N(C)[C@@H](C(=O)NCCc1ccccc1)C(C)C)C(C)C)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C44H77N7O6/c1-26(2)25-33(45-13)41(54)48(14)36(29(7)8)40(53)47-34(27(3)4)42(55)50(16)37(30(9)10)44(57)51(17)38(31(11)12)43(56)49(15)35(28(5)6)39(52)46-24-23-32-21-19-18-20-22-32/h18-22,26-31,33-38,45H,23-25H2,1-17H3,(H,46,52)(H,47,53)/t33-,34+,35+,36+,37+,38+/m0/s1 |
| InChIKey | VLFWVZNKJFXIER-RLLYISHSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus nematophila (ncbitaxon:628) | - | PubMed (24038745) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhabdopeptide 5 (CHEBI:219368) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-N,4-dimethyl-2-(methylamino)-N-[(2R)-3-methyl-1-[[(2R)-3-methyl-1-[methyl-[(2R)-3-methyl-1-[methyl-[(2R)-3-methyl-1-[methyl-[(2R)-3-methyl-1-oxo-1-(2-phenylethylamino)butan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 78442829 | ChemSpider |