EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H68N6O5 |
| Net Charge | 0 |
| Average Mass | 701.010 |
| Monoisotopic Mass | 700.52512 |
| SMILES | CN[C@H](CC(C)C)C(=O)N(C)[C@@H](C(=O)N(C)[C@@H](C(=O)N(C)[C@@H](C(=O)N(C)[C@@H](C(=O)NCCc1ccccc1)C(C)C)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C39H68N6O5/c1-24(2)23-30(40-11)36(47)43(13)32(26(5)6)38(49)45(15)34(28(9)10)39(50)44(14)33(27(7)8)37(48)42(12)31(25(3)4)35(46)41-22-21-29-19-17-16-18-20-29/h16-20,24-28,30-34,40H,21-23H2,1-15H3,(H,41,46)/t30-,31-,32-,33-,34-/m1/s1 |
| InChIKey | YLALJSZFQDXHJJ-SLXQPGMDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus nematophila (ncbitaxon:628) | - | PubMed (24038745) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhabdopeptide 3 (CHEBI:219355) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-N,4-dimethyl-2-(methylamino)-N-[(2R)-3-methyl-1-[methyl-[(2R)-3-methyl-1-[methyl-[(2R)-3-methyl-1-[methyl-[(2R)-3-methyl-1-oxo-1-(2-phenylethylamino)butan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]amino]-1-oxobutan-2-yl]pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 78442827 | ChemSpider |