EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H55N5O4 |
| Net Charge | 0 |
| Average Mass | 573.823 |
| Monoisotopic Mass | 573.42541 |
| SMILES | CN[C@@H](C(=O)N(C)[C@H](CC(C)C)C(=O)N[C@@H](C(=O)N(C)[C@@H](C(=O)NCCc1ccccc1)C(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C32H55N5O4/c1-20(2)19-25(36(10)31(40)26(33-9)21(3)4)29(38)35-27(22(5)6)32(41)37(11)28(23(7)8)30(39)34-18-17-24-15-13-12-14-16-24/h12-16,20-23,25-28,33H,17-19H2,1-11H3,(H,34,39)(H,35,38)/t25-,26-,27-,28-/m1/s1 |
| InChIKey | KMULXIYSBJRYMS-BIYDSLDMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdus nematophila (ncbitaxon:628) | - | PubMed (24038745) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rhabdopeptide 2 (CHEBI:219350) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-4-methyl-2-[methyl-[(2R)-3-methyl-2-(methylamino)butanoyl]amino]-N-[(2R)-3-methyl-1-[methyl-[(2R)-3-methyl-1-oxo-1-(2-phenylethylamino)butan-2-yl]amino]-1-oxobutan-2-yl]pentanamide |
| Manual Xrefs | Databases |
|---|---|
| 78442826 | ChemSpider |