EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N6O6 |
| Net Charge | 0 |
| Average Mass | 626.714 |
| Monoisotopic Mass | 626.28528 |
| SMILES | CCC(=O)N[C@@H]1C(=O)N[C@@H](Cc2cnc3ccccc23)C(=O)N[C@H](Cc2cnc3ccccc23)C(=O)N2CCC[C@H]2C(=O)O[C@@H]1C |
| InChI | InChI=1S/C34H38N6O6/c1-3-29(41)39-30-19(2)46-34(45)28-13-8-14-40(28)33(44)27(16-21-18-36-25-12-7-5-10-23(21)25)38-31(42)26(37-32(30)43)15-20-17-35-24-11-6-4-9-22(20)24/h4-7,9-12,17-19,26-28,30,35-36H,3,8,13-16H2,1-2H3,(H,37,43)(H,38,42)(H,39,41)/t19-,26+,27-,28+,30+/m1/s1 |
| InChIKey | YNNVIZAKAVCBIS-MEUYHONQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdusspecies (ncbitaxon:51785) | - | PubMed (28993611) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xeneprotide C (CHEBI:219345) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| N-[(3R,6S,9S,10R,13S)-3,6-bis(1H-indol-3-ylmethyl)-10-methyl-2,5,8,12-tetraoxo-11-oxa-1,4,7-triazabicyclo[11.3.0]hexadecan-9-yl]propanamide |