EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H40N6O6 |
| Net Charge | 0 |
| Average Mass | 688.785 |
| Monoisotopic Mass | 688.30093 |
| SMILES | C[C@H]1OC(=O)[C@@H]2CCCN2C(=O)[C@@H](Cc2cnc3ccccc23)NC(=O)[C@H](Cc2cnc3ccccc23)NC(=O)[C@H]1NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C39H40N6O6/c1-23-35(44-34(46)18-24-10-3-2-4-11-24)37(48)42-31(19-25-21-40-29-14-7-5-12-27(25)29)36(47)43-32(20-26-22-41-30-15-8-6-13-28(26)30)38(49)45-17-9-16-33(45)39(50)51-23/h2-8,10-15,21-23,31-33,35,40-41H,9,16-20H2,1H3,(H,42,48)(H,43,47)(H,44,46)/t23-,31+,32-,33+,35+/m1/s1 |
| InChIKey | LXPNBOVHJXILAR-MLVOZCEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Xenorhabdusspecies (ncbitaxon:51785) | - | PubMed (28993611) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Xeneprotide A (CHEBI:219335) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| N-[(3R,6S,9S,10R,13S)-3,6-bis(1H-indol-3-ylmethyl)-10-methyl-2,5,8,12-tetraoxo-11-oxa-1,4,7-triazabicyclo[11.3.0]hexadecan-9-yl]-2-phenylacetamide |