EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H42N8O11 |
| Net Charge | 0 |
| Average Mass | 678.700 |
| Monoisotopic Mass | 678.29730 |
| SMILES | NCCCCNC(=O)[C@H](Cc1cnc2ccccc12)NC(=O)[C@H](CO)NC(=O)[C@H](NC(=O)[C@H](CCCN(O)C=O)NC=O)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C29H42N8O11/c30-9-3-4-10-31-25(42)21(12-17-13-32-19-7-2-1-6-18(17)19)34-27(44)22(14-38)35-28(45)23(24(41)29(46)47)36-26(43)20(33-15-39)8-5-11-37(48)16-40/h1-2,6-7,13,15-16,20-24,32,38,41,48H,3-5,8-12,14,30H2,(H,31,42)(H,33,39)(H,34,44)(H,35,45)(H,36,43)(H,46,47)/t20-,21-,22-,23+,24+/m0/s1 |
| InChIKey | ZHXJYWKTMXEUFE-ZROJVYTPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia thailandensis E264 (ncbitaxon:271848) | - | PubMed (25873483) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malleobactin H (CHEBI:219309) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R,3R)-4-[[(2S)-1-[[(2S)-1-(4-aminobutylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-[[(2S)-2-ormamido-5-[ormyl(hydroxy)amino]pentanoyl]amino]-2-hydroxy-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438705 | ChemSpider |