EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H41N7O10 |
| Net Charge | 0 |
| Average Mass | 611.653 |
| Monoisotopic Mass | 611.29149 |
| SMILES | NCCCCNC(=O)[C@H](CCCN(O)C=O)NC(=O)[C@H](CO)NC(=O)[C@H](NC(=O)[C@@H](N)Cc1ccccc1)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C26H41N7O10/c27-10-4-5-11-29-23(38)18(9-6-12-33(43)15-35)30-24(39)19(14-34)31-25(40)20(21(36)26(41)42)32-22(37)17(28)13-16-7-2-1-3-8-16/h1-3,7-8,15,17-21,34,36,43H,4-6,9-14,27-28H2,(H,29,38)(H,30,39)(H,31,40)(H,32,37)(H,41,42)/t17-,18-,19-,20+,21+/m0/s1 |
| InChIKey | OFUZNSFXARNGLI-ALGQRKQJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia thailandensis E264 (ncbitaxon:271848) | - | PubMed (25873483) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malleobactin G (CHEBI:219301) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2R,3R)-4-[[(2S)-1-[[(2S)-1-(4-aminobutylamino)-5-[ormyl(hydroxy)amino]-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-[[(2S)-2-amino-3-phenylpropanoyl]amino]-2-hydroxy-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438704 | ChemSpider |