EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H43N7O11 |
| Net Charge | 0 |
| Average Mass | 605.646 |
| Monoisotopic Mass | 605.30206 |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CO)NC(=O)[C@H](NC(=O)[C@H](CCCN(O)C=O)NC=O)[C@@H](O)C(=O)O)C(=O)NCCCCN |
| InChI | InChI=1S/C24H43N7O11/c1-14(2)10-16(20(36)26-8-4-3-7-25)28-22(38)17(11-32)29-23(39)18(19(35)24(40)41)30-21(37)15(27-12-33)6-5-9-31(42)13-34/h12-19,32,35,42H,3-11,25H2,1-2H3,(H,26,36)(H,27,33)(H,28,38)(H,29,39)(H,30,37)(H,40,41)/t15-,16-,17-,18+,19+/m0/s1 |
| InChIKey | QSLSHPMCGQEYQR-LTFXXXRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia thailandensis E264 (ncbitaxon:271848) | - | PubMed (25873483) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malleobactin F (CHEBI:219295) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R,3R)-4-[[(2S)-1-[[(2S)-1-(4-aminobutylamino)-4-methyl-1-oxopentan-2-yl]amino]-3-hydroxy-1-oxopropan-2-yl]amino]-3-[[(2S)-2-ormamido-5-[ormyl(hydroxy)amino]pentanoyl]amino]-2-hydroxy-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78438703 | ChemSpider |