EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H54N2O4 |
| Net Charge | 0 |
| Average Mass | 506.772 |
| Monoisotopic Mass | 506.40836 |
| SMILES | CCC(C)[C@@H]1NC(=O)[C@H](C(C)C)NC(=O)/C(C)=C/C(C)CC(C)CC(C)CC(C)CCC(C)OC1=O |
| InChI | InChI=1S/C30H54N2O4/c1-11-23(8)27-30(35)36-25(10)13-12-19(4)14-20(5)15-21(6)16-22(7)17-24(9)28(33)31-26(18(2)3)29(34)32-27/h17-23,25-27H,11-16H2,1-10H3,(H,31,33)(H,32,34)/b24-17+/t19?,20?,21?,22?,23?,25?,26-,27-/m0/s1 |
| InChIKey | YHHLNGAZCXMCEW-YZJMRPAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus terreus (ncbitaxon:33178) | - | PubMed (28604695) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Valactamide A (CHEBI:219262) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3S,6S,9E)-3-butan-2-yl-9,11,13,15,17,20-hexamethyl-6-propan-2-yl-1-oxa-4,7-diazacycloicos-9-ene-2,5,8-trione |