EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48N10O10 |
| Net Charge | 0 |
| Average Mass | 672.741 |
| Monoisotopic Mass | 672.35549 |
| SMILES | CC(=O)N[C@@H](CCCN(O)C(C)=O)C(=O)N[C@H](CCCN=C(N)N)C(=O)N(O)CCC[C@@H]1NC(=O)[C@H](CCCN(O)C(C)=O)NC1=O |
| InChI | InChI=1S/C27H48N10O10/c1-16(38)31-19(9-5-13-35(45)17(2)39)23(41)34-22(8-4-12-30-27(28)29)26(44)37(47)15-7-11-21-25(43)32-20(24(42)33-21)10-6-14-36(46)18(3)40/h19-22,45-47H,4-15H2,1-3H3,(H,31,38)(H,32,43)(H,33,42)(H,34,41)(H4,28,29,30)/t19-,20-,21-,22+/m0/s1 |
| InChIKey | NURAPJVEDOAWHT-MYGLTJDJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salinisporaspecies (ncbitaxon:1979206) | - | PubMed (28809850) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Salinichelin B (CHEBI:219197) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2R)-2-[[(2S)-2-acetamido-5-[acetyl(hydroxy)amino]pentanoyl]amino]-N-[3-[(2S,5S)-5-[3-[acetyl(hydroxy)amino]propyl]-3,6-dioxopiperazin-2-yl]propyl]-5-(diaminomethylideneamino)-N-hydroxypentanamide |